C22H27BrN2O5S — CID 17357163
5-bromo-N-[4-(cyclohexylsulfamoyl)phenyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 17357163) has the molecular formula C22H27BrN2O5S and a molecular weight of 511.44 g/mol. Its IUPAC name is 5-bromo-N-[4-(cyclohexylsulfamoyl)phenyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | 5-bromo-N-[4-(cyclohexylsulfamoyl)phenyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17357163 |
| Molecular Formula | C22H27BrN2O5S |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | 5-bromo-N-[4-(cyclohexylsulfamoyl)phenyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H27BrN2O5S/c1-29-13-14-30-21-12-7-16(23)15-20(21)22(26)24-17-8-10-19(11-9-17)31(27,28)25-18-5-3-2-4-6-18/h7-12,15,18,25H,2-6,13-14H2,1H3,(H,24,26) |
| InChIKey | JZUZDVFWQLPUOM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|