C20H25BrN2O5S — CID 17357251
5-bromo-N-[4-(tert-butylsulfamoyl)phenyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 17357251) has the molecular formula C20H25BrN2O5S and a molecular weight of 485.40 g/mol. Its IUPAC name is 5-bromo-N-[4-(tert-butylsulfamoyl)phenyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | 5-bromo-N-[4-(tert-butylsulfamoyl)phenyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17357251 |
| Molecular Formula | C20H25BrN2O5S |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 5-bromo-N-[4-(tert-butylsulfamoyl)phenyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H25BrN2O5S/c1-20(2,3)23-29(25,26)16-8-6-15(7-9-16)22-19(24)17-13-14(21)5-10-18(17)28-12-11-27-4/h5-10,13,23H,11-12H2,1-4H3,(H,22,24) |
| InChIKey | IDAPFVKGPKREKG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|