C17H14BrCl3N2O3 — CID 21343973
N-[4-[(3-bromo-2-methylpropanoyl)amino]-5-chloro-2-hydroxyphenyl]-3,4-dichlorobenzamide (PubChem CID 21343973) has the molecular formula C17H14BrCl3N2O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is N-[4-[(3-bromo-2-methylpropanoyl)amino]-5-chloro-2-hydroxyphenyl]-3,4-dichlorobenzamide.
| Compound Name | N-[4-[(3-bromo-2-methylpropanoyl)amino]-5-chloro-2-hydroxyphenyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 21343973 |
| Molecular Formula | C17H14BrCl3N2O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 477.93 |
| IUPAC Name | N-[4-[(3-bromo-2-methylpropanoyl)amino]-5-chloro-2-hydroxyphenyl]-3,4-dichlorobenzamide |
| SMILES | CC(CBr)C(=O)Nc1cc(O)c(NC(=O)c2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C17H14BrCl3N2O3/c1-8(7-18)16(25)22-13-6-15(24)14(5-12(13)21)23-17(26)9-2-3-10(19)11(20)4-9/h2-6,8,24H,7H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | OGQYQPOOMSZIND-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|