C24H22Cl3N3O5S — CID 59943232
3,4-dichloro-N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]benzamide (PubChem CID 59943232) has the molecular formula C24H22Cl3N3O5S and a molecular weight of 570.88 g/mol. Its IUPAC name is 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 59943232 |
| Molecular Formula | C24H22Cl3N3O5S |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 569.03 |
| IUPAC Name | 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)CC(=O)Nc2cc(O)c(NC(=O)c3ccc(Cl)c(Cl)c3)cc2Cl)cc1 |
| InChI | InChI=1S/C24H22Cl3N3O5S/c1-13-3-6-16(7-4-13)36(34,35)30-14(2)9-23(32)28-20-12-22(31)21(11-19(20)27)29-24(33)15-5-8-17(25)18(26)10-15/h3-8,10-12,14,30-31H,9H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | FBWVHFMWKOHICY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|