C32H29ClN4O5S — CID 59943230
N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]-1-phenylindole-3-carboxamide (PubChem CID 59943230) has the molecular formula C32H29ClN4O5S and a molecular weight of 617.13 g/mol. Its IUPAC name is N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]-1-phenylindole-3-carboxamide.
| Compound Name | N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]-1-phenylindole-3-carboxamide |
|---|---|
| PubChem CID | 59943230 |
| Molecular Formula | C32H29ClN4O5S |
| Molecular Weight | 617.13 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]-1-phenylindole-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)CC(=O)Nc2cc(O)c(NC(=O)c3cn(-c4ccccc4)c4ccccc34)cc2Cl)cc1 |
| InChI | InChI=1S/C32H29ClN4O5S/c1-20-12-14-23(15-13-20)43(41,42)36-21(2)16-31(39)34-27-18-30(38)28(17-26(27)33)35-32(40)25-19-37(22-8-4-3-5-9-22)29-11-7-6-10-24(25)29/h3-15,17-19,21,36,38H,16H2,1-2H3,(H,34,39)(H,35,40) |
| InChIKey | MKYLAFXEBIOQBN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.13 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|