C27H26ClN5O5S — CID 59943240
N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 59943240) has the molecular formula C27H26ClN5O5S and a molecular weight of 568.06 g/mol. Its IUPAC name is N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 59943240 |
| Molecular Formula | C27H26ClN5O5S |
| Molecular Weight | 568.06 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | N-[5-chloro-2-hydroxy-4-[3-[(4-methylphenyl)sulfonylamino]butanoylamino]phenyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)CC(=O)Nc2cc(O)c(NC(=O)c3cnn(-c4ccccc4)c3)cc2Cl)cc1 |
| InChI | InChI=1S/C27H26ClN5O5S/c1-17-8-10-21(11-9-17)39(37,38)32-18(2)12-26(35)30-23-14-25(34)24(13-22(23)28)31-27(36)19-15-29-33(16-19)20-6-4-3-5-7-20/h3-11,13-16,18,32,34H,12H2,1-2H3,(H,30,35)(H,31,36) |
| InChIKey | VRUPZHSSGLZVQK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.06 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|