C33H29N5O8S — CID 18740330
N-[2-hydroxy-4-[2-(4-methylphenyl)sulfonylbutanoylamino]-5-(4-nitrophenoxy)phenyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 18740330) has the molecular formula C33H29N5O8S and a molecular weight of 655.69 g/mol. Its IUPAC name is N-[2-hydroxy-4-[2-(4-methylphenyl)sulfonylbutanoylamino]-5-(4-nitrophenoxy)phenyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[2-hydroxy-4-[2-(4-methylphenyl)sulfonylbutanoylamino]-5-(4-nitrophenoxy)phenyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18740330 |
| Molecular Formula | C33H29N5O8S |
| Molecular Weight | 655.69 g/mol |
| Exact Mass | 655.17 |
| IUPAC Name | N-[2-hydroxy-4-[2-(4-methylphenyl)sulfonylbutanoylamino]-5-(4-nitrophenoxy)phenyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | CCC(C(=O)Nc1cc(O)c(NC(=O)c2cnn(-c3ccccc3)c2)cc1Oc1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H29N5O8S/c1-3-31(47(44,45)26-15-9-21(2)10-16-26)33(41)36-28-17-29(39)27(18-30(28)46-25-13-11-24(12-14-25)38(42)43)35-32(40)22-19-34-37(20-22)23-7-5-4-6-8-23/h4-20,31,39H,3H2,1-2H3,(H,35,40)(H,36,41) |
| InChIKey | DQTAMGGTXDBOOX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.69 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|