C33H34N2O7S — CID 22886532
N-[2-hydroxy-5-(4-methoxyphenoxy)-4-[2-(4-methylphenyl)sulfonylpentanoylamino]phenyl]-4-methylbenzamide (PubChem CID 22886532) has the molecular formula C33H34N2O7S and a molecular weight of 602.71 g/mol. Its IUPAC name is N-[2-hydroxy-5-(4-methoxyphenoxy)-4-[2-(4-methylphenyl)sulfonylpentanoylamino]phenyl]-4-methylbenzamide.
| Compound Name | N-[2-hydroxy-5-(4-methoxyphenoxy)-4-[2-(4-methylphenyl)sulfonylpentanoylamino]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 22886532 |
| Molecular Formula | C33H34N2O7S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | N-[2-hydroxy-5-(4-methoxyphenoxy)-4-[2-(4-methylphenyl)sulfonylpentanoylamino]phenyl]-4-methylbenzamide |
| SMILES | CCCC(C(=O)Nc1cc(O)c(NC(=O)c2ccc(C)cc2)cc1Oc1ccc(OC)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H34N2O7S/c1-5-6-31(43(39,40)26-17-9-22(3)10-18-26)33(38)35-28-19-29(36)27(34-32(37)23-11-7-21(2)8-12-23)20-30(28)42-25-15-13-24(41-4)14-16-25/h7-20,31,36H,5-6H2,1-4H3,(H,34,37)(H,35,38) |
| InChIKey | AHYBGBMPSBWXAS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|