C26H28N2O5S — CID 20607003
N-[4-[2-(3,5-dimethylphenyl)sulfonylbutanoylamino]-2-hydroxyphenyl]-4-methylbenzamide (PubChem CID 20607003) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-[4-[2-(3,5-dimethylphenyl)sulfonylbutanoylamino]-2-hydroxyphenyl]-4-methylbenzamide.
| Compound Name | N-[4-[2-(3,5-dimethylphenyl)sulfonylbutanoylamino]-2-hydroxyphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 20607003 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N-[4-[2-(3,5-dimethylphenyl)sulfonylbutanoylamino]-2-hydroxyphenyl]-4-methylbenzamide |
| SMILES | CCC(C(=O)Nc1ccc(NC(=O)c2ccc(C)cc2)c(O)c1)S(=O)(=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C26H28N2O5S/c1-5-24(34(32,33)21-13-17(3)12-18(4)14-21)26(31)27-20-10-11-22(23(29)15-20)28-25(30)19-8-6-16(2)7-9-19/h6-15,24,29H,5H2,1-4H3,(H,27,31)(H,28,30) |
| InChIKey | CPVZMHCFFBRHPZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|