C26H27N3O5S — CID 90802618
N-(4-formamido-3-hydroxyphenyl)-2-(3-methylphenyl)sulfonylbutanamide;4-methylbenzonitrile (PubChem CID 90802618) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-(4-formamido-3-hydroxyphenyl)-2-(3-methylphenyl)sulfonylbutanamide;4-methylbenzonitrile.
| Compound Name | N-(4-formamido-3-hydroxyphenyl)-2-(3-methylphenyl)sulfonylbutanamide;4-methylbenzonitrile |
|---|---|
| PubChem CID | 90802618 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-(4-formamido-3-hydroxyphenyl)-2-(3-methylphenyl)sulfonylbutanamide;4-methylbenzonitrile |
| SMILES | CCC(C(=O)Nc1ccc(NC=O)c(O)c1)S(=O)(=O)c1cccc(C)c1.Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H20N2O5S.C8H7N/c1-3-17(26(24,25)14-6-4-5-12(2)9-14)18(23)20-13-7-8-15(19-11-21)16(22)10-13;1-7-2-4-8(6-9)5-3-7/h4-11,17,22H,3H2,1-2H3,(H,19,21)(H,20,23);2-5H,1H3 |
| InChIKey | YWRZCNKCAQQHPT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|