C30H30N2O6S — CID 22950650
N-[2-hydroxy-5-(4-methoxyphenoxy)-4-[1-(4-methylphenyl)sulfonylethylamino]phenyl]-4-methylbenzamide (PubChem CID 22950650) has the molecular formula C30H30N2O6S and a molecular weight of 546.65 g/mol. Its IUPAC name is N-[2-hydroxy-5-(4-methoxyphenoxy)-4-[1-(4-methylphenyl)sulfonylethylamino]phenyl]-4-methylbenzamide.
| Compound Name | N-[2-hydroxy-5-(4-methoxyphenoxy)-4-[1-(4-methylphenyl)sulfonylethylamino]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 22950650 |
| Molecular Formula | C30H30N2O6S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | N-[2-hydroxy-5-(4-methoxyphenoxy)-4-[1-(4-methylphenyl)sulfonylethylamino]phenyl]-4-methylbenzamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)c3ccc(C)cc3)c(O)cc2NC(C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H30N2O6S/c1-19-5-9-22(10-6-19)30(34)32-26-18-29(38-24-13-11-23(37-4)12-14-24)27(17-28(26)33)31-21(3)39(35,36)25-15-7-20(2)8-16-25/h5-18,21,31,33H,1-4H3,(H,32,34) |
| InChIKey | NKAGOVNPDJECDW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|