C29H20F5N3O6 — CID 20618157
2,3,4,5,6-pentafluoro-N-[5-hydroxy-4-[[(2Z)-2-hydroxyimino-2-(4-methylphenyl)acetyl]amino]-2-(4-methoxyphenoxy)phenyl]benzamide (PubChem CID 20618157) has the molecular formula C29H20F5N3O6 and a molecular weight of 601.48 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[5-hydroxy-4-[[(2Z)-2-hydroxyimino-2-(4-methylphenyl)acetyl]amino]-2-(4-methoxyphenoxy)phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[5-hydroxy-4-[[(2Z)-2-hydroxyimino-2-(4-methylphenyl)acetyl]amino]-2-(4-methoxyphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 20618157 |
| Molecular Formula | C29H20F5N3O6 |
| Molecular Weight | 601.48 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[5-hydroxy-4-[[(2Z)-2-hydroxyimino-2-(4-methylphenyl)acetyl]amino]-2-(4-methoxyphenoxy)phenyl]benzamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)/C(=N\O)c3ccc(C)cc3)c(O)cc2NC(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C29H20F5N3O6/c1-13-3-5-14(6-4-13)27(37-41)29(40)35-17-12-20(43-16-9-7-15(42-2)8-10-16)18(11-19(17)38)36-28(39)21-22(30)24(32)26(34)25(33)23(21)31/h3-12,38,41H,1-2H3,(H,35,40)(H,36,39)/b37-27- |
| InChIKey | JMKMSVXWFZRDQV-QOSQFQCFSA-N |
| XLogP | 6.27 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|