C23H19ClN4O3S — CID 55839751
N-[3-(benzenesulfonamido)-4-methylphenyl]-1-(4-chlorophenyl)pyrazole-4-carboxamide (PubChem CID 55839751) has the molecular formula C23H19ClN4O3S and a molecular weight of 466.95 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)-4-methylphenyl]-1-(4-chlorophenyl)pyrazole-4-carboxamide.
| Compound Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-1-(4-chlorophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55839751 |
| Molecular Formula | C23H19ClN4O3S |
| Molecular Weight | 466.95 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-1-(4-chlorophenyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cnn(-c3ccc(Cl)cc3)c2)cc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19ClN4O3S/c1-16-7-10-19(13-22(16)27-32(30,31)21-5-3-2-4-6-21)26-23(29)17-14-25-28(15-17)20-11-8-18(24)9-12-20/h2-15,27H,1H3,(H,26,29) |
| InChIKey | UUWGHYPKORGCRH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.95 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |