C24H21Cl3N2O5S — CID 58828158
3,4-dichloro-N-[5-chloro-2-hydroxy-4-[(Z)-1-(hydroxyamino)-2-(3-methylphenyl)sulfonylbut-1-enyl]phenyl]benzamide (PubChem CID 58828158) has the molecular formula C24H21Cl3N2O5S and a molecular weight of 555.87 g/mol. Its IUPAC name is 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[(Z)-1-(hydroxyamino)-2-(3-methylphenyl)sulfonylbut-1-enyl]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[(Z)-1-(hydroxyamino)-2-(3-methylphenyl)sulfonylbut-1-enyl]phenyl]benzamide |
|---|---|
| PubChem CID | 58828158 |
| Molecular Formula | C24H21Cl3N2O5S |
| Molecular Weight | 555.87 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[(Z)-1-(hydroxyamino)-2-(3-methylphenyl)sulfonylbut-1-enyl]phenyl]benzamide |
| SMILES | CC/C(=C(/NO)c1cc(O)c(NC(=O)c2ccc(Cl)c(Cl)c2)cc1Cl)S(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C24H21Cl3N2O5S/c1-3-22(35(33,34)15-6-4-5-13(2)9-15)23(29-32)16-11-21(30)20(12-18(16)26)28-24(31)14-7-8-17(25)19(27)10-14/h4-12,29-30,32H,3H2,1-2H3,(H,28,31)/b23-22- |
| InChIKey | LWFGMBXOPLQJHG-FCQUAONHSA-N |
| XLogP | 6.44 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.87 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|