C25H23ClN4O6S — CID 59940402
N-[5-chloro-2-hydroxy-4-[2-(4-methoxyphenyl)sulfonylpropanoylamino]phenyl]-1-methylindazole-6-carboxamide (PubChem CID 59940402) has the molecular formula C25H23ClN4O6S and a molecular weight of 543.00 g/mol. Its IUPAC name is N-[5-chloro-2-hydroxy-4-[2-(4-methoxyphenyl)sulfonylpropanoylamino]phenyl]-1-methylindazole-6-carboxamide.
| Compound Name | N-[5-chloro-2-hydroxy-4-[2-(4-methoxyphenyl)sulfonylpropanoylamino]phenyl]-1-methylindazole-6-carboxamide |
|---|---|
| PubChem CID | 59940402 |
| Molecular Formula | C25H23ClN4O6S |
| Molecular Weight | 543.00 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | N-[5-chloro-2-hydroxy-4-[2-(4-methoxyphenyl)sulfonylpropanoylamino]phenyl]-1-methylindazole-6-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)C(C)C(=O)Nc2cc(O)c(NC(=O)c3ccc4cnn(C)c4c3)cc2Cl)cc1 |
| InChI | InChI=1S/C25H23ClN4O6S/c1-14(37(34,35)18-8-6-17(36-3)7-9-18)24(32)28-20-12-23(31)21(11-19(20)26)29-25(33)15-4-5-16-13-27-30(2)22(16)10-15/h4-14,31H,1-3H3,(H,28,32)(H,29,33) |
| InChIKey | KFLLTDQYKKUEIG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.00 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|