C11H10N6O — CID 110475562
1-methyl-N-(1H-1,2,4-triazol-5-yl)indazole-6-carboxamide (PubChem CID 110475562) has the molecular formula C11H10N6O and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-methyl-N-(1H-1,2,4-triazol-5-yl)indazole-6-carboxamide.
| Compound Name | 1-methyl-N-(1H-1,2,4-triazol-5-yl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 110475562 |
| Molecular Formula | C11H10N6O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-methyl-N-(1H-1,2,4-triazol-5-yl)indazole-6-carboxamide |
| SMILES | Cn1ncc2ccc(C(=O)Nc3ncn[nH]3)cc21 |
| InChI | InChI=1S/C11H10N6O/c1-17-9-4-7(2-3-8(9)5-14-17)10(18)15-11-12-6-13-16-11/h2-6H,1H3,(H2,12,13,15,16,18) |
| InChIKey | XCUPBKMXZSGGJE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |