C21H23ClN4O3 — CID 22950647
N-[2-chloro-4-[(4-cyanophenyl)carbamoylamino]-5-hydroxyphenyl]-2-methylhexanamide (PubChem CID 22950647) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[2-chloro-4-[(4-cyanophenyl)carbamoylamino]-5-hydroxyphenyl]-2-methylhexanamide.
| Compound Name | N-[2-chloro-4-[(4-cyanophenyl)carbamoylamino]-5-hydroxyphenyl]-2-methylhexanamide |
|---|---|
| PubChem CID | 22950647 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[2-chloro-4-[(4-cyanophenyl)carbamoylamino]-5-hydroxyphenyl]-2-methylhexanamide |
| SMILES | CCCCC(C)C(=O)Nc1cc(O)c(NC(=O)Nc2ccc(C#N)cc2)cc1Cl |
| InChI | InChI=1S/C21H23ClN4O3/c1-3-4-5-13(2)20(28)25-17-11-19(27)18(10-16(17)22)26-21(29)24-15-8-6-14(12-23)7-9-15/h6-11,13,27H,3-5H2,1-2H3,(H,25,28)(H2,24,26,29) |
| InChIKey | ZUMFHXWIVCQADD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|