C21H25ClN2O3 — CID 38008825
N-butyl-2-[[(2R)-2-(2-chlorophenoxy)butanoyl]amino]benzamide (PubChem CID 38008825) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-butyl-2-[[(2R)-2-(2-chlorophenoxy)butanoyl]amino]benzamide.
| Compound Name | N-butyl-2-[[(2R)-2-(2-chlorophenoxy)butanoyl]amino]benzamide |
|---|---|
| PubChem CID | 38008825 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-butyl-2-[[(2R)-2-(2-chlorophenoxy)butanoyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=O)[C@@H](CC)Oc1ccccc1Cl |
| InChI | InChI=1S/C21H25ClN2O3/c1-3-5-14-23-20(25)15-10-6-8-12-17(15)24-21(26)18(4-2)27-19-13-9-7-11-16(19)22/h6-13,18H,3-5,14H2,1-2H3,(H,23,25)(H,24,26)/t18-/m1/s1 |
| InChIKey | AXYGKLVBGMMRMK-GOSISDBHSA-N |
| XLogP | 4.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|