C16H24ClNO3 — CID 43885641
2-(2-chlorophenoxy)-N-(3-propan-2-yloxypropyl)butanamide (PubChem CID 43885641) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-(3-propan-2-yloxypropyl)butanamide.
| Compound Name | 2-(2-chlorophenoxy)-N-(3-propan-2-yloxypropyl)butanamide |
|---|---|
| PubChem CID | 43885641 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-(3-propan-2-yloxypropyl)butanamide |
| SMILES | CCC(Oc1ccccc1Cl)C(=O)NCCCOC(C)C |
| InChI | InChI=1S/C16H24ClNO3/c1-4-14(21-15-9-6-5-8-13(15)17)16(19)18-10-7-11-20-12(2)3/h5-6,8-9,12,14H,4,7,10-11H2,1-3H3,(H,18,19) |
| InChIKey | IPVGAQGVXYRLQV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|