C28H30N4O5 — CID 102116612
1-(4-cyanophenyl)-3-[2-hydroxy-4-nitro-5-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]phenyl]urea (PubChem CID 102116612) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[2-hydroxy-4-nitro-5-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]phenyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[2-hydroxy-4-nitro-5-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]phenyl]urea |
|---|---|
| PubChem CID | 102116612 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[2-hydroxy-4-nitro-5-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]phenyl]urea |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(Oc2cc(NC(=O)Nc3ccc(C#N)cc3)c(O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H30N4O5/c1-27(2,3)17-28(4,5)19-8-12-21(13-9-19)37-25-14-22(24(33)15-23(25)32(35)36)31-26(34)30-20-10-6-18(16-29)7-11-20/h6-15,33H,17H2,1-5H3,(H2,30,31,34) |
| InChIKey | NDXBSTUMSAXDGA-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 137.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|