C23H15F6N3O2 — CID 126674515
1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-cyanophenoxy)-4-methylphenyl]urea (PubChem CID 126674515) has the molecular formula C23H15F6N3O2 and a molecular weight of 479.38 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-cyanophenoxy)-4-methylphenyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-cyanophenoxy)-4-methylphenyl]urea |
|---|---|
| PubChem CID | 126674515 |
| Molecular Formula | C23H15F6N3O2 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-cyanophenoxy)-4-methylphenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H15F6N3O2/c1-13-2-5-17(11-20(13)34-19-6-3-14(12-30)4-7-19)31-21(33)32-18-9-15(22(24,25)26)8-16(10-18)23(27,28)29/h2-11H,1H3,(H2,31,32,33) |
| InChIKey | ZCXZGWUKCBDBOF-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |