C22H13F6N3O2 — CID 91668273
1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(3-cyanophenoxy)phenyl]urea (PubChem CID 91668273) has the molecular formula C22H13F6N3O2 and a molecular weight of 465.35 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(3-cyanophenoxy)phenyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(3-cyanophenoxy)phenyl]urea |
|---|---|
| PubChem CID | 91668273 |
| Molecular Formula | C22H13F6N3O2 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-(3-cyanophenoxy)phenyl]urea |
| SMILES | N#Cc1cccc(Oc2ccc(NC(=O)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2)c1 |
| InChI | InChI=1S/C22H13F6N3O2/c23-21(24,25)14-9-15(22(26,27)28)11-17(10-14)31-20(32)30-16-4-6-18(7-5-16)33-19-3-1-2-13(8-19)12-29/h1-11H,(H2,30,31,32) |
| InChIKey | BFJYTCJKZKLEJS-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |