C17H14F3NO5 — CID 59821012
methyl 2-[4-methyl-3-[4-(trifluoromethoxy)phenoxy]anilino]-2-oxoacetate (PubChem CID 59821012) has the molecular formula C17H14F3NO5 and a molecular weight of 369.30 g/mol. Its IUPAC name is methyl 2-[4-methyl-3-[4-(trifluoromethoxy)phenoxy]anilino]-2-oxoacetate.
| Compound Name | methyl 2-[4-methyl-3-[4-(trifluoromethoxy)phenoxy]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 59821012 |
| Molecular Formula | C17H14F3NO5 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | methyl 2-[4-methyl-3-[4-(trifluoromethoxy)phenoxy]anilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ccc(C)c(Oc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H14F3NO5/c1-10-3-4-11(21-15(22)16(23)24-2)9-14(10)25-12-5-7-13(8-6-12)26-17(18,19)20/h3-9H,1-2H3,(H,21,22) |
| InChIKey | YYUTTWNABWWIMV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|