C18H17F3N2O4 — CID 24951963
methyl 2-[4-(dimethylamino)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate (PubChem CID 24951963) has the molecular formula C18H17F3N2O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is methyl 2-[4-(dimethylamino)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate.
| Compound Name | methyl 2-[4-(dimethylamino)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 24951963 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | methyl 2-[4-(dimethylamino)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ccc(N(C)C)c(-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H17F3N2O4/c1-23(2)15-9-6-12(22-16(24)17(25)26-3)10-14(15)11-4-7-13(8-5-11)27-18(19,20)21/h4-10H,1-3H3,(H,22,24) |
| InChIKey | GSYDLRNSNZSRNN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|