C16H12F3NO5 — CID 70806286
methyl 2-[4-hydroxy-2-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate (PubChem CID 70806286) has the molecular formula C16H12F3NO5 and a molecular weight of 355.27 g/mol. Its IUPAC name is methyl 2-[4-hydroxy-2-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate.
| Compound Name | methyl 2-[4-hydroxy-2-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 70806286 |
| Molecular Formula | C16H12F3NO5 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | methyl 2-[4-hydroxy-2-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ccc(O)cc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F3NO5/c1-24-15(23)14(22)20-13-7-4-10(21)8-12(13)9-2-5-11(6-3-9)25-16(17,18)19/h2-8,21H,1H3,(H,20,22) |
| InChIKey | ASFBGEFSJGEIFP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|