C26H23F4NO5 — CID 172695615
ethyl 3-(4-fluoro-3-methoxyanilino)-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]but-2-enoate (PubChem CID 172695615) has the molecular formula C26H23F4NO5 and a molecular weight of 505.46 g/mol. Its IUPAC name is ethyl 3-(4-fluoro-3-methoxyanilino)-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]but-2-enoate.
| Compound Name | ethyl 3-(4-fluoro-3-methoxyanilino)-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 172695615 |
| Molecular Formula | C26H23F4NO5 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | ethyl 3-(4-fluoro-3-methoxyanilino)-2-[4-[4-(trifluoromethoxy)phenoxy]phenyl]but-2-enoate |
| SMILES | CCOC(=O)C(=C(C)Nc1ccc(F)c(OC)c1)c1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H23F4NO5/c1-4-34-25(32)24(16(2)31-18-7-14-22(27)23(15-18)33-3)17-5-8-19(9-6-17)35-20-10-12-21(13-11-20)36-26(28,29)30/h5-15,31H,4H2,1-3H3 |
| InChIKey | STLOGSQWBNYFBI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|