C36H41N7O2S2 — CID 20657477
3-[5-[1,3-benzothiazol-2-yl(cyano)methyl]sulfanyltetrazol-1-yl]-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]benzamide (PubChem CID 20657477) has the molecular formula C36H41N7O2S2 and a molecular weight of 667.91 g/mol. Its IUPAC name is 3-[5-[1,3-benzothiazol-2-yl(cyano)methyl]sulfanyltetrazol-1-yl]-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]benzamide.
| Compound Name | 3-[5-[1,3-benzothiazol-2-yl(cyano)methyl]sulfanyltetrazol-1-yl]-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]benzamide |
|---|---|
| PubChem CID | 20657477 |
| Molecular Formula | C36H41N7O2S2 |
| Molecular Weight | 667.91 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | 3-[5-[1,3-benzothiazol-2-yl(cyano)methyl]sulfanyltetrazol-1-yl]-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]benzamide |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)c2cccc(-n3nnnc3SC(C#N)c3nc4ccccc4s3)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C36H41N7O2S2/c1-7-35(3,4)25-17-18-29(27(22-25)36(5,6)8-2)45-20-12-19-38-32(44)24-13-11-14-26(21-24)43-34(40-41-42-43)47-31(23-37)33-39-28-15-9-10-16-30(28)46-33/h9-11,13-18,21-22,31H,7-8,12,19-20H2,1-6H3,(H,38,44) |
| InChIKey | HEWFFFFDBNOSMM-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.91 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|