C17H16FN5O2 — CID 39483104
N-[3-(2-fluorophenoxy)propyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 39483104) has the molecular formula C17H16FN5O2 and a molecular weight of 341.35 g/mol. Its IUPAC name is N-[3-(2-fluorophenoxy)propyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[3-(2-fluorophenoxy)propyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 39483104 |
| Molecular Formula | C17H16FN5O2 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-[3-(2-fluorophenoxy)propyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NCCCOc1ccccc1F)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C17H16FN5O2/c18-15-7-1-2-8-16(15)25-10-4-9-19-17(24)13-5-3-6-14(11-13)23-12-20-21-22-23/h1-3,5-8,11-12H,4,9-10H2,(H,19,24) |
| InChIKey | BBXLGNBOVJRTHM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|