C15H19N5O2 — CID 51222719
N-[3-(cyclopropylmethoxy)propyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 51222719) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[3-(cyclopropylmethoxy)propyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[3-(cyclopropylmethoxy)propyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 51222719 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[3-(cyclopropylmethoxy)propyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NCCCOCC1CC1)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C15H19N5O2/c21-15(16-7-2-8-22-10-12-5-6-12)13-3-1-4-14(9-13)20-11-17-18-19-20/h1,3-4,9,11-12H,2,5-8,10H2,(H,16,21) |
| InChIKey | VXPDRHXEPKRXIA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|