C17H14Cl2N6O2 — CID 34812905
3,4-dichloro-N-[2-[[3-(tetrazol-1-yl)benzoyl]amino]ethyl]benzamide (PubChem CID 34812905) has the molecular formula C17H14Cl2N6O2 and a molecular weight of 405.25 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[3-(tetrazol-1-yl)benzoyl]amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[[3-(tetrazol-1-yl)benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 34812905 |
| Molecular Formula | C17H14Cl2N6O2 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 3,4-dichloro-N-[2-[[3-(tetrazol-1-yl)benzoyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(Cl)c(Cl)c1)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C17H14Cl2N6O2/c18-14-5-4-12(9-15(14)19)17(27)21-7-6-20-16(26)11-2-1-3-13(8-11)25-10-22-23-24-25/h1-5,8-10H,6-7H2,(H,20,26)(H,21,27) |
| InChIKey | POINQPAHQGEQAA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|