C20H16Cl2N4O4 — CID 86873544
3,4-dichloro-N-[2-[[3-(3,6-dioxo-1H-pyridazin-2-yl)benzoyl]amino]ethyl]benzamide (PubChem CID 86873544) has the molecular formula C20H16Cl2N4O4 and a molecular weight of 447.28 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[3-(3,6-dioxo-1H-pyridazin-2-yl)benzoyl]amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[[3-(3,6-dioxo-1H-pyridazin-2-yl)benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 86873544 |
| Molecular Formula | C20H16Cl2N4O4 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 3,4-dichloro-N-[2-[[3-(3,6-dioxo-1H-pyridazin-2-yl)benzoyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(Cl)c(Cl)c1)c1cccc(-n2[nH]c(=O)ccc2=O)c1 |
| InChI | InChI=1S/C20H16Cl2N4O4/c21-15-5-4-13(11-16(15)22)20(30)24-9-8-23-19(29)12-2-1-3-14(10-12)26-18(28)7-6-17(27)25-26/h1-7,10-11H,8-9H2,(H,23,29)(H,24,30)(H,25,27) |
| InChIKey | XZWKVAZJYMOLKT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|