C22H23N5O3 — CID 86873608
3-(3,6-dioxo-1H-pyridazin-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide (PubChem CID 86873608) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 86873608 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3cccc(-n4[nH]c(=O)ccc4=O)c3)cc2)CC1 |
| InChI | InChI=1S/C22H23N5O3/c1-25-11-13-26(14-12-25)18-7-5-17(6-8-18)23-22(30)16-3-2-4-19(15-16)27-21(29)10-9-20(28)24-27/h2-10,15H,11-14H2,1H3,(H,23,30)(H,24,28) |
| InChIKey | SOPBXLZWHYJWJU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|