C26H30N4O3 — CID 86873553
N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-(3,6-dioxo-1H-pyridazin-2-yl)benzamide (PubChem CID 86873553) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-(3,6-dioxo-1H-pyridazin-2-yl)benzamide.
| Compound Name | N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-(3,6-dioxo-1H-pyridazin-2-yl)benzamide |
|---|---|
| PubChem CID | 86873553 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)piperidin-4-yl]-3-(3,6-dioxo-1H-pyridazin-2-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(N2CCC(NC(=O)c3cccc(-n4[nH]c(=O)ccc4=O)c3)CC2)cc1 |
| InChI | InChI=1S/C26H30N4O3/c1-26(2,3)19-7-9-21(10-8-19)29-15-13-20(14-16-29)27-25(33)18-5-4-6-22(17-18)30-24(32)12-11-23(31)28-30/h4-12,17,20H,13-16H2,1-3H3,(H,27,33)(H,28,31) |
| InChIKey | VRAWPSCRWPBCBB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |