C15H11BrFN5O — CID 46460818
N-[(5-bromo-2-fluorophenyl)methyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 46460818) has the molecular formula C15H11BrFN5O and a molecular weight of 376.19 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 46460818 |
| Molecular Formula | C15H11BrFN5O |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NCc1cc(Br)ccc1F)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C15H11BrFN5O/c16-12-4-5-14(17)11(6-12)8-18-15(23)10-2-1-3-13(7-10)22-9-19-20-21-22/h1-7,9H,8H2,(H,18,23) |
| InChIKey | IKPVQBLUTREEGP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |