C12H9BrFN3O — CID 113264962
N-[(5-bromo-2-fluorophenyl)methyl]pyridazine-4-carboxamide (PubChem CID 113264962) has the molecular formula C12H9BrFN3O and a molecular weight of 310.13 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]pyridazine-4-carboxamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 113264962 |
| Molecular Formula | C12H9BrFN3O |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]pyridazine-4-carboxamide |
| SMILES | O=C(NCc1cc(Br)ccc1F)c1ccnnc1 |
| InChI | InChI=1S/C12H9BrFN3O/c13-10-1-2-11(14)9(5-10)6-15-12(18)8-3-4-16-17-7-8/h1-5,7H,6H2,(H,15,18) |
| InChIKey | HKGYFSYJLJYHIP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |