C29H41N5O2S2 — CID 20679496
1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-[[3-(3-methylphenyl)sulfanyl-1,2,4-thiadiazol-5-yl]amino]urea (PubChem CID 20679496) has the molecular formula C29H41N5O2S2 and a molecular weight of 555.81 g/mol. Its IUPAC name is 1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-[[3-(3-methylphenyl)sulfanyl-1,2,4-thiadiazol-5-yl]amino]urea.
| Compound Name | 1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-[[3-(3-methylphenyl)sulfanyl-1,2,4-thiadiazol-5-yl]amino]urea |
|---|---|
| PubChem CID | 20679496 |
| Molecular Formula | C29H41N5O2S2 |
| Molecular Weight | 555.81 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-[[3-(3-methylphenyl)sulfanyl-1,2,4-thiadiazol-5-yl]amino]urea |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)NNc2nc(Sc3cccc(C)c3)ns2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C29H41N5O2S2/c1-8-28(4,5)21-14-15-24(23(19-21)29(6,7)9-2)36-17-11-16-30-25(35)32-33-26-31-27(34-38-26)37-22-13-10-12-20(3)18-22/h10,12-15,18-19H,8-9,11,16-17H2,1-7H3,(H2,30,32,35)(H,31,33,34) |
| InChIKey | HDGPCVBWDIHVHV-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.81 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|