C28H47N5OS3 — CID 20679493
1-(2-hexyldecyl)-3-[[3-[2-(3-methylphenyl)sulfanylethylsulfanyl]-1,2,4-thiadiazol-5-yl]amino]urea (PubChem CID 20679493) has the molecular formula C28H47N5OS3 and a molecular weight of 565.92 g/mol. Its IUPAC name is 1-(2-hexyldecyl)-3-[[3-[2-(3-methylphenyl)sulfanylethylsulfanyl]-1,2,4-thiadiazol-5-yl]amino]urea.
| Compound Name | 1-(2-hexyldecyl)-3-[[3-[2-(3-methylphenyl)sulfanylethylsulfanyl]-1,2,4-thiadiazol-5-yl]amino]urea |
|---|---|
| PubChem CID | 20679493 |
| Molecular Formula | C28H47N5OS3 |
| Molecular Weight | 565.92 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 1-(2-hexyldecyl)-3-[[3-[2-(3-methylphenyl)sulfanylethylsulfanyl]-1,2,4-thiadiazol-5-yl]amino]urea |
| SMILES | CCCCCCCCC(CCCCCC)CNC(=O)NNc1nc(SCCSc2cccc(C)c2)ns1 |
| InChI | InChI=1S/C28H47N5OS3/c1-4-6-8-10-11-13-17-24(16-12-9-7-5-2)22-29-26(34)31-32-27-30-28(33-37-27)36-20-19-35-25-18-14-15-23(3)21-25/h14-15,18,21,24H,4-13,16-17,19-20,22H2,1-3H3,(H2,29,31,34)(H,30,32,33) |
| InChIKey | KPPLSJVLQWVYMC-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.92 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|