C27H41N3O6S2 — CID 22957701
1-[[2,4-bis(2-methylbutan-2-yl)phenoxy]methyl]-3-[2-methyl-4,5-bis(methylsulfonyl)anilino]urea (PubChem CID 22957701) has the molecular formula C27H41N3O6S2 and a molecular weight of 567.77 g/mol. Its IUPAC name is 1-[[2,4-bis(2-methylbutan-2-yl)phenoxy]methyl]-3-[2-methyl-4,5-bis(methylsulfonyl)anilino]urea.
| Compound Name | 1-[[2,4-bis(2-methylbutan-2-yl)phenoxy]methyl]-3-[2-methyl-4,5-bis(methylsulfonyl)anilino]urea |
|---|---|
| PubChem CID | 22957701 |
| Molecular Formula | C27H41N3O6S2 |
| Molecular Weight | 567.77 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | 1-[[2,4-bis(2-methylbutan-2-yl)phenoxy]methyl]-3-[2-methyl-4,5-bis(methylsulfonyl)anilino]urea |
| SMILES | CCC(C)(C)c1ccc(OCNC(=O)NNc2cc(S(C)(=O)=O)c(S(C)(=O)=O)cc2C)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C27H41N3O6S2/c1-10-26(4,5)19-12-13-22(20(15-19)27(6,7)11-2)36-17-28-25(31)30-29-21-16-24(38(9,34)35)23(14-18(21)3)37(8,32)33/h12-16,29H,10-11,17H2,1-9H3,(H2,28,30,31) |
| InChIKey | GBSGFFBLRYHUMP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|