C21H33NO4 — CID 91096849
2-[[[2,4-bis(2-methylbutan-2-yl)phenoxy]methylamino]oxymethyl]propanedial (PubChem CID 91096849) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-[[[2,4-bis(2-methylbutan-2-yl)phenoxy]methylamino]oxymethyl]propanedial.
| Compound Name | 2-[[[2,4-bis(2-methylbutan-2-yl)phenoxy]methylamino]oxymethyl]propanedial |
|---|---|
| PubChem CID | 91096849 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 2-[[[2,4-bis(2-methylbutan-2-yl)phenoxy]methylamino]oxymethyl]propanedial |
| SMILES | CCC(C)(C)c1ccc(OCNOCC(C=O)C=O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C21H33NO4/c1-7-20(3,4)17-9-10-19(18(11-17)21(5,6)8-2)25-15-22-26-14-16(12-23)13-24/h9-13,16,22H,7-8,14-15H2,1-6H3 |
| InChIKey | CGKANJXBKNALHW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|