C26H39ClN2O3S — CID 170848974
3-amino-N-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-chlorobenzenesulfonamide (PubChem CID 170848974) has the molecular formula C26H39ClN2O3S and a molecular weight of 495.13 g/mol. Its IUPAC name is 3-amino-N-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-chlorobenzenesulfonamide.
| Compound Name | 3-amino-N-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 170848974 |
| Molecular Formula | C26H39ClN2O3S |
| Molecular Weight | 495.13 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 3-amino-N-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-chlorobenzenesulfonamide |
| SMILES | CCC(CNS(=O)(=O)c1ccc(Cl)c(N)c1)Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC |
| InChI | InChI=1S/C26H39ClN2O3S/c1-8-19(17-29-33(30,31)20-12-13-22(27)23(28)16-20)32-24-14-11-18(25(4,5)9-2)15-21(24)26(6,7)10-3/h11-16,19,29H,8-10,17,28H2,1-7H3 |
| InChIKey | QYHIKXKLZNXCOU-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.13 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|