C8H9ClF2N2O2S — CID 115405354
3-amino-4-chloro-N-(2,2-difluoroethyl)benzenesulfonamide (PubChem CID 115405354) has the molecular formula C8H9ClF2N2O2S and a molecular weight of 270.69 g/mol. Its IUPAC name is 3-amino-4-chloro-N-(2,2-difluoroethyl)benzenesulfonamide.
| Compound Name | 3-amino-4-chloro-N-(2,2-difluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115405354 |
| Molecular Formula | C8H9ClF2N2O2S |
| Molecular Weight | 270.69 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 3-amino-4-chloro-N-(2,2-difluoroethyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCC(F)F)ccc1Cl |
| InChI | InChI=1S/C8H9ClF2N2O2S/c9-6-2-1-5(3-7(6)12)16(14,15)13-4-8(10)11/h1-3,8,13H,4,12H2 |
| InChIKey | OJNVDDHYJSZUNW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.69 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|