C15H22O3 — CID 71089254
2-[2-methyl-4-(2-methylbutan-2-yl)phenoxy]propanoic acid (PubChem CID 71089254) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[2-methyl-4-(2-methylbutan-2-yl)phenoxy]propanoic acid.
| Compound Name | 2-[2-methyl-4-(2-methylbutan-2-yl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 71089254 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-[2-methyl-4-(2-methylbutan-2-yl)phenoxy]propanoic acid |
| SMILES | CCC(C)(C)c1ccc(OC(C)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C15H22O3/c1-6-15(4,5)12-7-8-13(10(2)9-12)18-11(3)14(16)17/h7-9,11H,6H2,1-5H3,(H,16,17) |
| InChIKey | BKGYZOLZDYGKMI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |