C33H50O3 — CID 152602466
(2,4-ditert-butylphenyl) 5-tert-butyl-4-hydroxy-2-(3,4,4-trimethylpentyl)benzoate (PubChem CID 152602466) has the molecular formula C33H50O3 and a molecular weight of 494.76 g/mol. Its IUPAC name is (2,4-ditert-butylphenyl) 5-tert-butyl-4-hydroxy-2-(3,4,4-trimethylpentyl)benzoate.
| Compound Name | (2,4-ditert-butylphenyl) 5-tert-butyl-4-hydroxy-2-(3,4,4-trimethylpentyl)benzoate |
|---|---|
| PubChem CID | 152602466 |
| Molecular Formula | C33H50O3 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.38 |
| IUPAC Name | (2,4-ditert-butylphenyl) 5-tert-butyl-4-hydroxy-2-(3,4,4-trimethylpentyl)benzoate |
| SMILES | CC(CCc1cc(O)c(C(C)(C)C)cc1C(=O)Oc1ccc(C(C)(C)C)cc1C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C33H50O3/c1-21(30(2,3)4)14-15-22-18-27(34)25(32(8,9)10)20-24(22)29(35)36-28-17-16-23(31(5,6)7)19-26(28)33(11,12)13/h16-21,34H,14-15H2,1-13H3 |
| InChIKey | YXVCTFXGKWLOIY-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|