C23H37NO5 — CID 54183773
tert-butyl 3-[[2-(3,5-ditert-butyl-4-hydroxyphenoxy)-2-oxoethyl]amino]propanoate (PubChem CID 54183773) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is tert-butyl 3-[[2-(3,5-ditert-butyl-4-hydroxyphenoxy)-2-oxoethyl]amino]propanoate.
| Compound Name | tert-butyl 3-[[2-(3,5-ditert-butyl-4-hydroxyphenoxy)-2-oxoethyl]amino]propanoate |
|---|---|
| PubChem CID | 54183773 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | tert-butyl 3-[[2-(3,5-ditert-butyl-4-hydroxyphenoxy)-2-oxoethyl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNCC(=O)Oc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H37NO5/c1-21(2,3)16-12-15(13-17(20(16)27)22(4,5)6)28-19(26)14-24-11-10-18(25)29-23(7,8)9/h12-13,24,27H,10-11,14H2,1-9H3 |
| InChIKey | PDRZQVOPCRQAKX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|