C29H36O6S — CID 102579346
1-O-(2,6-ditert-butyl-4-methylphenyl) 6-O-ethyl (2E,4E)-3-(benzenesulfonyl)hexa-2,4-dienedioate (PubChem CID 102579346) has the molecular formula C29H36O6S and a molecular weight of 512.67 g/mol. Its IUPAC name is 1-O-(2,6-ditert-butyl-4-methylphenyl) 6-O-ethyl (2E,4E)-3-(benzenesulfonyl)hexa-2,4-dienedioate.
| Compound Name | 1-O-(2,6-ditert-butyl-4-methylphenyl) 6-O-ethyl (2E,4E)-3-(benzenesulfonyl)hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 102579346 |
| Molecular Formula | C29H36O6S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 1-O-(2,6-ditert-butyl-4-methylphenyl) 6-O-ethyl (2E,4E)-3-(benzenesulfonyl)hexa-2,4-dienedioate |
| SMILES | CCOC(=O)/C=C/C(=C\C(=O)Oc1c(C(C)(C)C)cc(C)cc1C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H36O6S/c1-9-34-25(30)16-15-22(36(32,33)21-13-11-10-12-14-21)19-26(31)35-27-23(28(3,4)5)17-20(2)18-24(27)29(6,7)8/h10-19H,9H2,1-8H3/b16-15+,22-19+ |
| InChIKey | PMKSGVNUBQJXPL-JWGQYYPISA-N |
| XLogP | 5.97 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|