C20H18O5S — CID 102579345
ethyl (2E,4E)-4-(benzenesulfonyl)-6-oxo-6-phenylhexa-2,4-dienoate (PubChem CID 102579345) has the molecular formula C20H18O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is ethyl (2E,4E)-4-(benzenesulfonyl)-6-oxo-6-phenylhexa-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-4-(benzenesulfonyl)-6-oxo-6-phenylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 102579345 |
| Molecular Formula | C20H18O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | ethyl (2E,4E)-4-(benzenesulfonyl)-6-oxo-6-phenylhexa-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(=C\C(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18O5S/c1-2-25-20(22)14-13-18(15-19(21)16-9-5-3-6-10-16)26(23,24)17-11-7-4-8-12-17/h3-15H,2H2,1H3/b14-13+,18-15+ |
| InChIKey | ZRYKTLBTTJSQQP-UUVOMYAKSA-N |
| XLogP | 3.35 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|