C17H16O8 — CID 173141247
4-O-(1-acetyloxy-1,3-dioxo-3-phenylpropan-2-yl) 1-O-ethyl but-2-enedioate (PubChem CID 173141247) has the molecular formula C17H16O8 and a molecular weight of 348.31 g/mol. Its IUPAC name is 4-O-(1-acetyloxy-1,3-dioxo-3-phenylpropan-2-yl) 1-O-ethyl but-2-enedioate.
| Compound Name | 4-O-(1-acetyloxy-1,3-dioxo-3-phenylpropan-2-yl) 1-O-ethyl but-2-enedioate |
|---|---|
| PubChem CID | 173141247 |
| Molecular Formula | C17H16O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-O-(1-acetyloxy-1,3-dioxo-3-phenylpropan-2-yl) 1-O-ethyl but-2-enedioate |
| SMILES | CCOC(=O)C=CC(=O)OC(C(=O)OC(C)=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O8/c1-3-23-13(19)9-10-14(20)25-16(17(22)24-11(2)18)15(21)12-7-5-4-6-8-12/h4-10,16H,3H2,1-2H3 |
| InChIKey | IAGRRHSGEZULSB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|