C18H19ClO2 — CID 155034421
ethyl (2Z,4E,6E)-4-chloro-6-methyl-8-phenylnona-2,4,6,8-tetraenoate (PubChem CID 155034421) has the molecular formula C18H19ClO2 and a molecular weight of 302.80 g/mol. Its IUPAC name is ethyl (2Z,4E,6E)-4-chloro-6-methyl-8-phenylnona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2Z,4E,6E)-4-chloro-6-methyl-8-phenylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 155034421 |
| Molecular Formula | C18H19ClO2 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | ethyl (2Z,4E,6E)-4-chloro-6-methyl-8-phenylnona-2,4,6,8-tetraenoate |
| SMILES | C=C(/C=C(C)/C=C(Cl)\C=C/C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C18H19ClO2/c1-4-21-18(20)11-10-17(19)13-14(2)12-15(3)16-8-6-5-7-9-16/h5-13H,3-4H2,1-2H3/b11-10-,14-12+,17-13+ |
| InChIKey | XHQPZEFXWVRZOH-BQPPLKKUSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|