C25H22O9 — CID 173141194
4-O-(1-acetyloxy-3-benzoyl-3-methyl-1,4-dioxo-4-phenylbutan-2-yl) 1-O-methyl but-2-enedioate (PubChem CID 173141194) has the molecular formula C25H22O9 and a molecular weight of 466.44 g/mol. Its IUPAC name is 4-O-(1-acetyloxy-3-benzoyl-3-methyl-1,4-dioxo-4-phenylbutan-2-yl) 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-(1-acetyloxy-3-benzoyl-3-methyl-1,4-dioxo-4-phenylbutan-2-yl) 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 173141194 |
| Molecular Formula | C25H22O9 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 4-O-(1-acetyloxy-3-benzoyl-3-methyl-1,4-dioxo-4-phenylbutan-2-yl) 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OC(C(=O)OC(C)=O)C(C)(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22O9/c1-16(26)33-24(31)23(34-20(28)15-14-19(27)32-3)25(2,21(29)17-10-6-4-7-11-17)22(30)18-12-8-5-9-13-18/h4-15,23H,1-3H3 |
| InChIKey | TWHUPQPBYRMEIY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|