About (2-amino-6-fluorophenyl) propanoate
(2-amino-6-fluorophenyl) propanoate (PubChem CID 70075863) has the molecular formula C9H10FNO2
and a molecular weight of 183.18 g/mol. Its IUPAC name is (2-amino-6-fluorophenyl) propanoate.
Molecular Properties
| Compound Name | (2-amino-6-fluorophenyl) propanoate |
| PubChem CID | 70075863 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | (2-amino-6-fluorophenyl) propanoate |
| SMILES | CCC(=O)Oc1c(N)cccc1F |
| InChI | InChI=1S/C9H10FNO2/c1-2-8(12)13-9-6(10)4-3-5-7(9)11/h3-5H,2,11H2,1H3 |
| InChIKey | XKNZIYSEIGEPIS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-6-fluorophenyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-6-fluorophenyl) propanoate?
The IUPAC name of (2-amino-6-fluorophenyl) propanoate (CID 70075863) is (2-amino-6-fluorophenyl) propanoate.
What is the SMILES notation for (2-amino-6-fluorophenyl) propanoate?
The canonical SMILES for (2-amino-6-fluorophenyl) propanoate is CCC(=O)Oc1c(N)cccc1F.
What is the InChIKey of (2-amino-6-fluorophenyl) propanoate?
The InChIKey is XKNZIYSEIGEPIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO2/c1-2-8(12)13-9-6(10)4-3-5-7(9)11/h3-5H,2,11H2,1H3.
What are the key properties of (2-amino-6-fluorophenyl) propanoate?
(2-amino-6-fluorophenyl) propanoate has a molecular weight of 183.18 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-6-fluorophenyl) propanoate is sourced from PubChem (CID 70075863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).